CAS 7542-45-2
:3,3'-dihydro-β,β-carotene-4,4'-dione
Description:
3,3'-Dihydro-β,β-carotene-4,4'-dione, with the CAS number 7542-45-2, is a carotenoid derivative characterized by its vibrant orange-red color, typical of many carotenoids. This compound features a polyene structure with conjugated double bonds, contributing to its strong light absorption properties, particularly in the visible spectrum. It is a diketone, indicating the presence of two carbonyl (C=O) groups, which can influence its reactivity and stability. The presence of these functional groups may also affect its antioxidant properties, making it of interest in various biological and nutritional studies. In terms of solubility, carotenoids are generally more soluble in organic solvents than in water, which is consistent with this compound. Its potential applications span from food coloring to health supplements, given the role of carotenoids in human health, particularly in vision and skin protection. However, specific stability and reactivity details would depend on environmental conditions such as pH, temperature, and exposure to light.
Formula:C40H52O4
InChI:InChI=1/C40H52O4/c1-27(17-13-19-29(3)21-23-33-31(5)37(43)35(41)25-39(33,7)8)15-11-12-16-28(2)18-14-20-30(4)22-24-34-32(6)38(44)36(42)26-40(34,9)10/h11-24,35-36,41-42H,25-26H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,27-15-,28-16+,29-19+,30-20+
InChI key:InChIKey=MQZIGYBFDRPAKN-QISQUURKNA-N
SMILES:C(=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=1C(C)(C)CC(O)C(=O)C1C)\C)\C)/C)/C)\C=2C(C)(C)CC(O)C(=O)C2C
Synonyms:- (13Cis)-3,3'-Dihydroxy-Beta,Beta-Carotene-4,4'-Dione
- 3,3'-Dihydro-beta,beta-carotene-4,4'-dione
- 3,3′-Dihydroxy-β,β-carotene-4,4′-dione
- Beta,Beta-Carotene-4,4'-Dione
- β,β-Carotene-4,4′-dione, 3,3′-dihydroxy-
- β-Carotene-4,4′-dione, 3,3′-dihydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Astaxanthin Esters from Haematococcus pluvialis
CAS:Edible preparations, not canned or frozen, not containing cane and/or beet sugar, nesoiFormula:C40H52O4(FreeAstaxanthin)Color and Shape:Dark Red Oily LiquidMolecular weight:596.38656Astaxanthin (Synthetic) (3,3'-dihydroxy-β,β-Carotene-4,4'-dione)
CAS:Other, including mixtures of coloring matter of two or more of the subheading 3204.11 to 3204.19, nesoiFormula:C40H52O4Color and Shape:Dark Violet PowderMolecular weight:596.386563,3'-Dihydroxy-β,β-carotene-4,4'-dione
CAS:Formula:C40H52O4Purity:97%Color and Shape:SolidMolecular weight:596.8385(rac./meso)-Astaxanthin
CAS:(rac./meso)-Astaxanthin (AstaREAL; AstaXin) is a carotenoid pigment primarily found in marine animals such as shrimp and salmon. It serves as an effective fat-soluble antioxidant.Formula:C40H52O4Color and Shape:SolidMolecular weight:596.84(rac./meso)-Astaxanthin
CAS:Controlled ProductApplications (rac./meso)-Astaxanthin is a carotenoid pigment responsible for the red colour in many fish and birds such as salmon and flamingoes.
References Storebakken, T., et al.: Aquaculture, 65, 279 (1987); Fox, D. L., et al.: Comp. Biochem. Physiol. B, 6, 1 (1962)Formula:C40H52O4Color and Shape:NeatMolecular weight:596.84rac-Astaxanthin
CAS:rac-Astaxanthin is a synthetic version of a naturally occurring carotenoid, which is sourced primarily from marine organisms such as microalgae, yeast, and crustaceans. Its mode of action involves functioning as a potent antioxidant, mitigating oxidative stress by neutralizing free radicals and reactive oxygen species at the cellular level.Formula:C40H52O4Purity:Min. 95%Molecular weight:596.8 g/mol







