CAS 754230-78-9

2-Amino-5-bromo-3-benzyloxypyridine

Description:

2-Amino-5-bromo-3-benzyloxypyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2, 5, and 3 positions. The presence of an amino group (-NH2) at the 2-position contributes to its basicity and potential for hydrogen bonding, while the bromine atom at the 5-position introduces electrophilic reactivity, making it useful in various synthetic applications. The benzyloxy group at the 3-position enhances the compound's lipophilicity and can influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the amino and bromine functionalities, which can participate in further chemical transformations. Additionally, the compound's unique combination of substituents may impart specific biological properties, making it a candidate for research in drug discovery and development.

Formula: C₁₂H₁₁BrN₂O

InChI: InChI=1/C12H11BrN2O/c13-10-6-11(12(14)15-7-10)16-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,14,15)

SMILES: c1ccc(cc1)COc1cc(cnc1N)Br

Synonyms:

• 3-Benzyloxy-5-bromo-2-pyridinamine
• 5-bromo-3-(phenylmethoxy)- 2-Pyridinamine
• 3-(Benzyloxy)-5-Bromopyridin-2-Amine

3-(Benzyloxy)-5-bromopyridin-2-amine

CAS: 754230-78-9

Formula: C₁₂H₁₁BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 279.1325

Ref: IN-DA005BIS

3-(Benzyloxy)-5-bromopyridin-2-amine

CAS: 754230-78-9

3-(Benzyloxy)-5-bromopyridin-2-amine

Purity: 97%

Molecular weight: 279.13g/mol

Ref: 54-OR90282

2-Amino-5-bromo-3-benzyloxypyridine

CAS: 754230-78-9

Formula: C₁₂H₁₁BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 279.137

Ref: 10-F216362