
CAS 75438-02-7
:7-Chloro-1,2-dimethyl-1H-benzimidazole
Description:
7-Chloro-1,2-dimethyl-1H-benzimidazole is a chemical compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. The presence of a chlorine atom at the 7-position and two methyl groups at the 1 and 2 positions contributes to its unique properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. It is often studied for its potential biological activities, including antimicrobial and antifungal properties, making it of interest in pharmaceutical research. The presence of the chlorine atom can enhance its reactivity and influence its interaction with biological targets. Additionally, the compound's structure may allow for various substitution reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H9ClN2
InChI:InChI=1S/C9H9ClN2/c1-6-11-8-5-3-4-7(10)9(8)12(6)2/h3-5H,1-2H3
InChI key:InChIKey=YELUSMFLNGPGAU-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1C)=CC=CC2Cl
Synonyms:- 7-Chloro-1,2-dimethyl-1H-benzimidazole
- 1H-Benzimidazole, 7-chloro-1,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.