CAS 75438-70-9

4,6-Dichloro-2-cyclopropyl-5-pyrimidinamine

Description:

4,6-Dichloro-2-cyclopropyl-5-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of two chlorine atoms at the 4 and 6 positions of the pyrimidine ring contributes to its reactivity and potential biological activity. The cyclopropyl group at the 2 position introduces strain and unique steric properties, which can influence the compound's interactions with biological targets. This compound is often studied for its potential applications in pharmaceuticals, particularly as an antitumor or antiviral agent, due to its ability to interfere with nucleic acid synthesis. Its molecular structure suggests it may exhibit specific binding affinities, making it a candidate for further research in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, which are important factors to consider in both laboratory and therapeutic contexts.

Formula: C₇H₇Cl₂N₃

InChI: InChI=1S/C7H7Cl2N3/c8-5-4(10)6(9)12-7(11-5)3-1-2-3/h3H,1-2,10H2

InChI key: InChIKey=OAIPRQSPYGPMAG-UHFFFAOYSA-N

SMILES: ClC1=NC(=NC(Cl)=C1N)C2CC2

Synonyms:

• 4,6-Dichloro-2-cyclopropyl-5-pyrimidinamine
• 5-Pyrimidinamine, 4,6-dichloro-2-cyclopropyl-