
CAS 7544-78-7
:1-(Phenylmethyl)-2-pyrrolidinimine
Description:
1-(Phenylmethyl)-2-pyrrolidinimine, with the CAS number 7544-78-7, is an organic compound characterized by its imine functional group and a pyrrolidine ring. This compound features a phenylmethyl group attached to the nitrogen atom of the pyrrolidine, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the imine group indicates that it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its solubility can vary based on the solvent used, and it may have moderate stability under standard conditions, although it can be sensitive to moisture and light. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C11H14N2
InChI:InChI=1S/C11H14N2/c12-11-7-4-8-13(11)9-10-5-2-1-3-6-10/h1-3,5-6,12H,4,7-9H2
InChI key:InChIKey=IVHXGNYBEYPWDW-UHFFFAOYSA-N
SMILES:C(N1C(=N)CCC1)C2=CC=CC=C2
Synonyms:- 2-Pyrrolidinimine, 1-(phenylmethyl)-
- Pyrrolidine, 1-benzyl-2-imino-
- 1-Benzylpyrrolidin-2-imine
- 1-(Phenylmethyl)-2-pyrrolidinimine
- 1-Benzyl-pyrrolidin-2-ylideneamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.