CAS 7545-54-2
:1,4-Dimethyl N,N-dimethyl-L-aspartate
Description:
1,4-Dimethyl N,N-dimethyl-L-aspartate, with the CAS number 7545-54-2, is a chemical compound that belongs to the class of amino acid derivatives. It is a synthetic analog of the neurotransmitter aspartate, which plays a crucial role in excitatory neurotransmission in the central nervous system. This compound features two methyl groups attached to the nitrogen atoms of the aspartate backbone, which can influence its biological activity and receptor binding properties. Typically, such modifications can enhance lipophilicity and alter pharmacokinetic profiles. The compound is often studied for its potential effects on glutamate receptors, particularly in the context of neuropharmacology and neurobiology. Its solubility characteristics, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. As with many amino acid derivatives, it may exhibit specific interactions with biological systems, making it of interest in research related to neurotransmission and potential therapeutic applications. However, safety and handling precautions should be observed due to its chemical nature.
Formula:C8H15NO4
InChI:InChI=1S/C8H15NO4/c1-9(2)6(8(11)13-4)5-7(10)12-3/h6H,5H2,1-4H3/t6-/m0/s1
InChI key:InChIKey=ARELCOFELBUQAT-LURJTMIESA-N
SMILES:[C@H](CC(OC)=O)(C(OC)=O)N(C)C
Synonyms:- Aspartic acid, N,N-dimethyl-, dimethyl ester
- 1,4-Dimethyl N,N-dimethyl-L-aspartate
- L-Aspartic acid, N,N-dimethyl-, 1,4-dimethyl ester
- L-Aspartic acid, N,N-dimethyl-, dimethyl ester
- (S)-Dimethyl 2-(dimethylamino)succinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
