CAS 75450-34-9

7-chloro-5-(2-chlorophenyl)-1,5-dihydro-4,1-benzothiazepin-2(3H)-one

Description:

7-Chloro-5-(2-chlorophenyl)-1,5-dihydro-4,1-benzothiazepin-2(3H)-one, with the CAS number 75450-34-9, is a chemical compound that belongs to the benzothiazepine class, which is characterized by a fused benzene and thiazepine ring structure. This compound features a chlorine atom at the 7-position and a 2-chlorophenyl group at the 5-position, contributing to its unique chemical properties and potential biological activity. Benzothiazepines are known for their diverse pharmacological effects, including anxiolytic, antihypertensive, and antiarrhythmic activities. The presence of halogen substituents, such as chlorine, can influence the compound's lipophilicity, reactivity, and interaction with biological targets. The molecular structure suggests potential for interactions with various receptors or enzymes, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by its specific functional groups and overall molecular geometry, which are critical for its application in pharmaceutical development.

Formula: C₁₅H₁₁Cl₂NOS

InChI: InChI=1/C15H11Cl2NOS/c16-9-5-6-13-11(7-9)15(20-8-14(19)18-13)10-3-1-2-4-12(10)17/h1-7,15H,8H2,(H,18,19)

SMILES: c1ccc(c(c1)C1c2cc(ccc2N=C(CS1)O)Cl)Cl

Synonyms:

• 4,1-Benzothiazepin-2(3H)-one, 7-chloro-5-(2-chlorophenyl)-1,5-dihydro-

CGP37157

CAS: 75450-34-9

CGP37157 (7-Chloro-5-(2-chlorophenyl)-1,5-dihydro-4,1-benzothiazepine-2(3H)-one) is a Na+/Ca2+ exchanger inhibitor, inhibits Na+-induced Ca2+ release from

Formula: C₁₅H₁₁Cl₂NOS

Purity: 99.92%

Color and Shape: Solid

Molecular weight: 324.22

Ref: TM-T14941

7-Chloro-5-(2-chlorophenyl)-1,5-dihydro-4,1-benzothiazepin-2(3H)-one

CAS: 75450-34-9

Formula: C₁₅H₁₁Cl₂NOS

Purity: 98%

Color and Shape: Solid

Molecular weight: 324.2249

Ref: IN-DA005X83

CGP37157

CAS: 75450-34-9

CGP37157

Purity: ≥98%

Molecular weight: 324.22g/mol

Ref: 54-BUP10371

CGP 37157

CAS: 75450-34-9

Formula: C₁₅H₁₁Cl₂NOS

Purity: >95.0%(HPLC)(qNMR)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 324.22

Ref: 3B-C3956