CAS 75459-34-6
:2,2'-{propane-1,2-diylbis[(2-amino-2-oxoethyl)imino]}diacetic acid
Description:
2,2'-{Propane-1,2-diylbis[(2-amino-2-oxoethyl)imino]}diacetic acid, identified by its CAS number 75459-34-6, is a complex organic compound characterized by its dual functional groups that include amino and carboxylic acid moieties. This substance is a chelating agent, meaning it has the ability to form stable complexes with metal ions, which is particularly useful in various applications such as metal ion sequestration and in biochemical processes. The presence of the imino and amino groups enhances its reactivity and solubility in aqueous environments, making it suitable for use in biological systems. Additionally, the diacetic acid structure contributes to its ability to interact with metal ions, facilitating its role in coordination chemistry. Its structural features suggest potential applications in pharmaceuticals, agriculture, and environmental chemistry, particularly in the development of agents that can selectively bind to and remove heavy metals from solutions. Overall, this compound exemplifies the intersection of organic chemistry and practical applications in various scientific fields.
Formula:C11H20N4O6
InChI:InChI=1/C11H20N4O6/c1-7(15(4-9(13)17)6-11(20)21)2-14(3-8(12)16)5-10(18)19/h7H,2-6H2,1H3,(H2,12,16)(H2,13,17)(H,18,19)(H,20,21)
SMILES:CC(CN(CC(=N)O)CC(=O)O)N(CC(=N)O)CC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dexrazoxane Impurity 32 Disodium Salt
CAS:Formula:C11H18N4O6·2NaColor and Shape:White To Off-White SolidMolecular weight:302.29 2*22.99ADR-925
CAS:ADR-925 has the ability to protect neonatal rat cardiomyocytes from doxorubicin-induced injury.Cost-effective and quality-assured.Formula:C11H20N4O6Purity:98% - 98%Color and Shape:SolidMolecular weight:304.3(S)-N,N'-(1-Methyl-1,2-ethanediyl)bis[N-(2-amino-2-oxoethyl)-glycine Disodium Salt
CAS:Controlled ProductStability Hygroscopic
Applications (S)-N,N'-(1-Methyl-1,2-ethanediyl)bis[N-(2-amino-2-oxoethyl)-glycine Disodium Salt is a metabolite of Dexrazoxane (D299050); a clinically used drug that is effective against anthracycline-induced cardiotoxicity and extravasation injury.
References Kovarikova, P., et al.: J. Pharmaceut. Biomed., 76, 243 (2013); Sterba, M., et al.: Antioxid. Redox Sign., 18, 899 (2013)Formula:C11H18N4Na2O6Color and Shape:NeatMolecular weight:348.263




