CAS 75462-58-7
:1-(Chloromethyl)-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]benzene
Description:
1-(Chloromethyl)-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]benzene, with the CAS number 75462-58-7, is a synthetic organic compound characterized by its complex structure, which includes a chloromethyl group and a tetrafluoroethyl moiety attached to a benzene ring. This compound is notable for its fluorinated groups, which impart unique chemical properties such as increased hydrophobicity and thermal stability. The presence of the chloromethyl group suggests potential reactivity, making it a candidate for further chemical transformations or applications in organic synthesis. Its fluorinated structure may also enhance its utility in specialized applications, including pharmaceuticals, agrochemicals, or materials science, where fluorinated compounds are often sought for their unique physical and chemical properties. The compound's stability and reactivity profile can be influenced by the electronic effects of the fluorine atoms, which can affect its behavior in various chemical environments. Safety and handling precautions should be observed due to the presence of chlorine and fluorine, which can pose health and environmental risks.
Formula:C10H6ClF7
InChI:InChI=1S/C10H6ClF7/c11-5-6-1-3-7(4-2-6)8(12,9(13,14)15)10(16,17)18/h1-4H,5H2
InChI key:InChIKey=YVFMXVCWQRNPID-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(F)(F)F)(F)C1=CC=C(CCl)C=C1
Synonyms:- 1-(Chloromethyl)-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]benzene
- Benzene, 1-(chloromethyl)-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.