CymitQuimica logo

CAS 75462-60-1

:

2-Chloro-4-methyl-1-(trifluoromethoxy)benzene

Description:
2-Chloro-4-methyl-1-(trifluoromethoxy)benzene, with the CAS number 75462-60-1, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, a methyl group, and a trifluoromethoxy group. The presence of the chlorine atom and the trifluoromethoxy group contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is often used in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds due to its ability to participate in electrophilic aromatic substitution reactions. Additionally, the trifluoromethoxy group enhances the compound's stability and can influence its biological activity. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested, and proper disposal methods should be followed to mitigate environmental impact.
Formula:C8H6ClF3O
InChI:InChI=1S/C8H6ClF3O/c1-5-2-3-7(6(9)4-5)13-8(10,11)12/h2-4H,1H3
InChI key:InChIKey=ZLALBYGRUCKRIQ-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(Cl)C=C(C)C=C1
Synonyms:
  • Benzene, 2-chloro-4-methyl-1-(trifluoromethoxy)-
  • 3-Chloro-4-trifluoromethoxytoluene
  • 2-Chloro-4-methyl-1-(trifluoromethoxy)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.