CAS 7547-96-8
:cis-Propenylboronic acid
Description:
Cis-Propenylboronic acid, with the CAS number 7547-96-8, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a propenyl chain. This compound typically exists as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, particularly in organic synthesis and medicinal chemistry. The cis configuration of the propenyl group influences its reactivity and interaction with biological molecules. Cis-Propenylboronic acid is soluble in polar organic solvents and exhibits moderate stability under standard conditions, although it can be sensitive to moisture and air, which may lead to hydrolysis. Its unique properties make it a useful reagent in the development of boron-containing compounds and in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C3H7BO2
InChI:InChI=1/C3H7BO2/c1-2-3-4(5)6/h2-3,5-6H,1H3/b3-2-
SMILES:C/C=C\B(O)O
Synonyms:- Prop-1-En-1-Ylboronic Acid
- (1Z)-prop-1-en-1-ylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[(Z)-Prop-1-enyl]boronic acid
CAS:[(Z)-Prop-1-enyl]boronic acidPurity:≥95%Color and Shape:SolidMolecular weight:85.90g/molcis-1-Propene-1-boronic Acid
CAS:Controlled ProductApplications cis-1-Propene-1-boronicacid (CAS# 7547-96-8) is a useful research chemical compound.
Formula:C3H7BO2Color and Shape:NeatMolecular weight:85.897cis-1-Propene-1-boronicacid
CAS:cis-1-Propene-1-boronicacid is a chiral, pyranoside compound that can be synthesized from the reaction of 2,3,4,5-tetrahydropyran with boron trichloride. cis-1-Propene-1-boronicacid has been shown to be useful for the palladium catalyzed cross coupling reactions. cis-1-Propene-1-boronicacid has been shown to react with cyclopentenone and alkylate different functional groups such as amines and alcohols. cis-1 -Propene 1 boronic acid has been used in peptidomimetics as well as in nature.Formula:C3H7BO2Purity:Min. 95%Molecular weight:85.9 g/mol



