CAS 75470-88-1

(1R)-1-cyano-2-ethoxy-2-oxoethanaminium

Description:

(1R)-1-cyano-2-ethoxy-2-oxoethanaminium, with the CAS number 75470-88-1, is a chemical compound characterized by its unique functional groups and stereochemistry. This substance features a cyano group (-CN), an ethoxy group (-OCH2CH3), and an oxo group (C=O) attached to a central ethanaminium structure, which indicates it possesses both amine and carbonyl functionalities. The presence of the cyano group suggests potential reactivity in nucleophilic addition reactions, while the ethoxy group can influence solubility and reactivity in organic solvents. The stereochemistry indicated by the (1R) designation implies that the compound has a specific three-dimensional arrangement, which can affect its biological activity and interaction with other molecules. Overall, this compound may be of interest in synthetic organic chemistry and could have applications in pharmaceuticals or agrochemicals, depending on its reactivity and biological properties. Further studies would be necessary to fully elucidate its characteristics and potential uses.

Formula: C₅H₉N₂O₂

InChI: InChI=1/C5H8N2O2/c1-2-9-5(8)4(7)3-6/h4H,2,7H2,1H3/p+1/t4-/m1/s1

[(S)-cyano-ethoxycarbonyl-methyl]azanium

CAS: 75470-88-1

[(S)-cyano-ethoxycarbonyl-methyl]azanium

Purity: 97%

Molecular weight: 346.29g/mol

Ref: 54-OR1042482