CymitQuimica logo

CAS 75473-11-9

:

1-(2-Methyl-3-nitrophenyl)ethanone

Description:
1-(2-Methyl-3-nitrophenyl)ethanone, with the CAS number 75473-11-9, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features a methyl group and a nitro group attached to a phenyl ring, which influences its chemical reactivity and physical properties. Typically, it appears as a solid or liquid depending on the specific conditions, and it may exhibit a distinct color due to the presence of the nitro group. The presence of the nitro group generally imparts electron-withdrawing characteristics, affecting the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. Safety data should be consulted for handling and storage, as nitro-substituted compounds can be sensitive and may pose health risks. Overall, 1-(2-Methyl-3-nitrophenyl)ethanone is a notable compound in organic chemistry with potential utility in various chemical applications.
Formula:C9H9NO3
InChI:InChI=1/C9H9NO3/c1-6-8(7(2)11)4-3-5-9(6)10(12)13/h3-5H,1-2H3
InChI key:HPQVXLJSJCOYFE-UHFFFAOYSA-N
SMILES:Cc1c(cccc1N(=O)=O)C(=O)C
Synonyms:
  • Ethanone, 1-(2-Methyl-3-Nitrophenyl)-
  • 1-(2-Methyl-3-nitrophenyl)ethanone
Found 3 products.