CAS 75476-36-7

1,3,5,7-tetranitrotricyclo[3.3.1.1~3,7~]decane

Description:

1,3,5,7-Tetranitrotricyclo[3.3.1.1^3,7]decane, commonly referred to as HMX (High Melting Explosive), is a powerful nitroamine explosive known for its stability and high energy output. It features a complex tricyclic structure with four nitro groups attached, which significantly enhance its explosive properties. HMX is characterized by its high density, low sensitivity to shock and friction, and excellent thermal stability, making it suitable for military and industrial applications. It is typically used in formulations for explosives, propellants, and as a component in composite explosives. The compound is relatively insoluble in water but can dissolve in organic solvents. HMX is known for its high detonation velocity and pressure, which contribute to its effectiveness in various explosive applications. Safety measures are essential when handling HMX due to its potential hazards, including toxicity and environmental impact. Overall, its unique structural features and energetic characteristics make it a significant compound in the field of explosives and propellants.

Formula: C₁₀H₁₂N₄O₈

InChI: InChI=1/C10H12N4O8/c15-11(16)7-1-8(12(17)18)4-9(2-7,13(19)20)6-10(3-7,5-8)14(21)22/h1-6H2

SMILES: C1C2(CC3(CC1(CC(C2)(C3)N(=O)=O)N(=O)=O)N(=O)=O)N(=O)=O

Synonyms:

• 1,3,5,7-Tetranitrotricyclo[3.3.1.13,7]Decane
• Tricyclo[3.3.1.1~3,7~]Decane, 1,3,5,7-Tetranitro-
• Tricyclo[3.3.1.13,7]Decane, 1,3,5,7-Tetranitro-

Vildagliptin Impurity 32

CAS: 75476-36-7

Formula: C₁₀H₁₂N₄O₈

Molecular weight: 316.23

Ref: 4Z-V-2243