CAS 75476-78-7
:5-bromo-1H-indene
Description:
5-Bromo-1H-indene is an organic compound characterized by its indene structure, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of a bromine atom at the 5-position of the indene ring significantly influences its chemical properties and reactivity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as electrophilic substitutions and cross-coupling reactions. The bromine substituent can also serve as a useful handle for further functionalization. In terms of safety, like many brominated compounds, it should be handled with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory settings.
Formula:C9H7Br
InChI:InChI=1/C9H7Br/c10-9-5-4-7-2-1-3-8(7)6-9/h1,3-6H,2H2
SMILES:C1=Cc2cc(ccc2C1)Br
Synonyms:- 1H-indene, 5-bromo-
- 5-Bromo-1H-indene
- 5-Bromo-1H-indene 95+%
- SKL641
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-1H-indene
CAS:5-Bromo-1H-indeneFormula:C9H7BrPurity:>97%Color and Shape:Solid-PowderMolecular weight:195.055885-Bromo-1H-indene
CAS:5-Bromo-1H-indene is the structural modification of naphthalene. This compound is a benzannulation product that can be systematically obtained through the addition of methoxy groups to the naphthalene ring. 5-Bromo-1H-indene has been shown to have a role in solar cells, as it can act as an electron donor and acceptor. This molecule also has a mechanistic role in transport, as it can bind to metal carbene complexes and form a stable complex with them. 5-Bromo-1H-indene has been used in the synthesis of biomolecules such as arene and fluorine, which are important for the treatment of cancer.Formula:C9H7BrPurity:Min. 95%Molecular weight:195.06 g/mol




