CymitQuimica logo

CAS 75487-84-2

:

6-fluoro-2-methyl-4H-chromen-4-one

Description:
6-Fluoro-2-methyl-4H-chromen-4-one, identified by its CAS number 75487-84-2, is a synthetic organic compound belonging to the class of flavonoids, specifically a chromone derivative. This compound features a chromone backbone, characterized by a benzopyran structure, with a fluorine atom and a methyl group substituent at the 6 and 2 positions, respectively. The presence of the fluorine atom can enhance the compound's biological activity and lipophilicity, potentially influencing its pharmacological properties. Typically, compounds in this class exhibit a range of biological activities, including antioxidant, anti-inflammatory, and antimicrobial effects. The molecular structure contributes to its stability and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, its solubility and interaction with biological systems can vary based on the substituents present, which may affect its application in various fields, including pharmaceuticals and agrochemicals. Overall, 6-fluoro-2-methyl-4H-chromen-4-one represents a valuable compound for further research and potential therapeutic applications.
Formula:C10H7FO2
InChI:InChI=1/C10H7FO2/c1-6-4-9(12)8-5-7(11)2-3-10(8)13-6/h2-5H,1H3
SMILES:Cc1cc(=O)c2cc(ccc2o1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.