CAS 7549-44-2
:Phenylenediacrylicaciddimethylester; 95%
Description:
Phenylenediacrylic acid dimethyl ester, with the CAS number 7549-44-2, is an organic compound characterized by its structure, which includes two acrylic acid moieties linked by a phenylene group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is known for its reactivity, particularly in polymerization processes, making it useful in the synthesis of various polymers and copolymers. The presence of ester functional groups contributes to its solubility in organic solvents, while the acrylic components allow for UV light absorption, which can be advantageous in applications such as coatings and adhesives. Additionally, the compound may exhibit properties such as low volatility and moderate stability under standard conditions. Safety considerations should be taken into account, as it may pose risks such as skin and eye irritation. Overall, phenylenediacrylic acid dimethyl ester is a versatile chemical with applications in materials science and polymer chemistry.
Formula:C14H14O4
InChI:InChI=1/C14H14O4/c1-17-13(15)9-7-11-3-5-12(6-4-11)8-10-14(16)18-2/h3-10H,1-2H3/b9-7+,10-8+
Synonyms:- 1,4-Phenylenediacrylic acid dimethyl ester
- dimethyl (2E,2'E)-3,3'-benzene-1,4-diylbisprop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
methyl (2E)-3-{4-[(1E)-3-methoxy-3-oxoprop-1-en-1-yl]phenyl}prop-2-enoate
CAS:Formula:C14H14O4Purity:95%Color and Shape:SolidMolecular weight:246.2586Dimethyl 1,4-Phenylenediacrylate
CAS:Dimethyl 1,4-PhenylenediacrylatePurity:95%Molecular weight:246.26g/molDimethyl 1,4-Phenylenediacrylate
CAS:Formula:C14H14O4Purity:>95.0%(GC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:246.26dimethyl (2E,2’E)-3,3′-(1,4-phenylene)bisacrylate
CAS:Formula:C14H14O4Purity:≥95%Molecular weight:246.262



