CAS 754973-68-7
:5-(chloromethyl)-1-(2-methoxyethyl)imidazole
Description:
5-(Chloromethyl)-1-(2-methoxyethyl)imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a chloromethyl group at the 5-position and a 2-methoxyethyl substituent at the 1-position contributes to its unique reactivity and solubility properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane, while its solubility in water is limited due to the hydrophobic nature of the methoxyethyl group. The chloromethyl group makes it a potential electrophile, allowing for various nucleophilic substitution reactions. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of the chloromethyl group.
Formula:C7H11ClN2O
InChI:InChI=1/C7H11ClN2O/c1-11-3-2-10-6-9-5-7(10)4-8/h5-6H,2-4H2,1H3
SMILES:COCCn1cncc1CCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.