CAS 754973-91-6
:[4-fluoro-2-(trifluoromethyl)phenyl]hydrazine
Description:
[4-Fluoro-2-(trifluoromethyl)phenyl]hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a phenyl ring that is substituted with both a fluorine atom and a trifluoromethyl group. The molecular structure features a phenyl ring with a fluorine atom at the para position and a trifluoromethyl group at the ortho position relative to the hydrazine moiety. This compound is likely to exhibit properties typical of hydrazines, such as being a potential reducing agent and having applications in organic synthesis and medicinal chemistry. The presence of multiple fluorine atoms enhances its lipophilicity and may influence its reactivity and stability. Additionally, the compound's unique electronic properties due to the electronegative fluorine substituents can affect its interaction with biological targets, making it of interest in pharmaceutical research. Safety considerations are important, as hydrazines are generally considered hazardous and may pose health risks.
Formula:C7H6F4N2
InChI:InChI=1/C7H6F4N2/c8-4-1-2-6(13-12)5(3-4)7(9,10)11/h1-3,13H,12H2
SMILES:c1cc(c(cc1F)C(F)(F)F)NN
Synonyms:- Hydrazine, [4-Fluoro-2-(Trifluoromethyl)Phenyl]-
- [4-Fluoro-2-(trifluoromethyl)phenyl]hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.