CAS 75500-02-6

1,3-dibenzyl-5-fluoropyrimidine-2,4(1H,3H)-dione

Description:

1,3-Dibenzyl-5-fluoropyrimidine-2,4(1H,3H)-dione is a synthetic organic compound characterized by its pyrimidine core, which features two benzyl groups and a fluorine atom. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but may have limited solubility in water. The presence of the fluorine atom can influence its reactivity and biological activity, often enhancing lipophilicity and altering pharmacokinetic properties. The compound may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural features that can interact with biological targets. Its unique structure allows for various chemical modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₁₈H₁₅FN₂O₂

InChI: InChI=1/C18H15FN2O2/c19-16-13-20(11-14-7-3-1-4-8-14)18(23)21(17(16)22)12-15-9-5-2-6-10-15/h1-10,13H,11-12H2

SMILES: c1ccc(cc1)Cn1cc(c(=O)n(Cc2ccccc2)c1=O)F

Synonyms:

• 5-Fluoro-1,3-bis[phenylmethyl]-2,4(1H,3H)-pyrimidinedione

1,3-Dibenzyl-5-fluorouracil

CAS: 75500-02-6

1,3-Dibenzyl-5-fluorouracil is a chemical inhibitor that suppresses the formation of osteoclasts, functioning by downregulating the signaling pathways of nuclear factor κB ligand receptor activator (Receptor activator of NF-κB ligand, RANKL) and macrophage colony-stimulating factor (M-CSF). This compound is used in the research of metabolic bone diseases.

Formula: C₁₈H₁₅FN₂O₂

Color and Shape: Solid

Molecular weight: 310.32

Ref: TM-T88494

1,3-Dibenzyl-5-fluorouracil

Controlled Product

CAS: 75500-02-6

Applications 1,3-Dibenzyl-5-fluorouracil (cas# 75500-02-6) is a compound useful in organic synthesis.

Formula: C₁₈H₁₅FN₂O₂

Color and Shape: Neat

Molecular weight: 310.32

Ref: TR-D417570