CAS 75500-03-7

1,3-bis(benzyloxymethyl)-5-fluoro-pyrimidine-2,4-dione

Description:

1,3-bis(benzyloxymethyl)-5-fluoro-pyrimidine-2,4-dione, with the CAS number 75500-03-7, is a synthetic organic compound characterized by its pyrimidine core, which features two benzyloxymethyl groups and a fluorine atom at the 5-position. This compound exhibits a range of chemical properties typical of pyrimidine derivatives, including potential reactivity due to the presence of the dione functional groups, which can participate in various chemical reactions such as nucleophilic additions or condensation reactions. The benzyloxymethyl substituents enhance its lipophilicity, potentially influencing its solubility and biological activity. The fluorine atom may impart unique electronic properties, affecting the compound's reactivity and interaction with biological targets. Due to its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions to determine its suitability for specific applications.

Formula: C₂₀H₁₉FN₂O₄

InChI: InChI=1/C20H19FN2O4/c21-18-11-22(14-26-12-16-7-3-1-4-8-16)20(25)23(19(18)24)15-27-13-17-9-5-2-6-10-17/h1-11H,12-15H2

SMILES: c1ccc(cc1)COCn1cc(c(=O)n(COCc2ccccc2)c1=O)F