CAS 755039-92-0

(3R)-1-Ethyl-3-pyrrolidinamine

Description:

(3R)-1-Ethyl-3-pyrrolidinamine, with the CAS number 755039-92-0, is a chiral amine characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features an ethyl group attached to the nitrogen atom of the pyrrolidine, contributing to its unique properties. As a chiral molecule, it exists in two enantiomeric forms, with the (3R) designation indicating the specific spatial arrangement of its atoms. This stereochemistry can significantly influence its biological activity and interactions with other molecules. Typically, such compounds are of interest in medicinal chemistry due to their potential applications in drug development, particularly in the design of pharmaceuticals that target specific biological pathways. The presence of the amine functional group suggests that it may participate in hydrogen bonding, affecting its solubility and reactivity. Overall, (3R)-1-Ethyl-3-pyrrolidinamine is a compound of interest for its structural features and potential applications in various chemical and biological contexts.

Formula: C₆H₁₄N₂

InChI: InChI=1S/C6H14N2/c1-2-8-4-3-6(7)5-8/h6H,2-5,7H2,1H3/t6-/m1/s1

InChI key: InChIKey=GOLVGZOPWLLUSF-ZCFIWIBFSA-N

SMILES: C(C)N1C[C@H](N)CC1

Synonyms:

• 3-Pyrrolidinamine, 1-ethyl-, (3R)-
• (3R)-1-Ethylpyrrolidin-3-amine
• (3R)-1-Ethyl-3-pyrrolidinamine
• (R)-1-ethylpyrrolidin-3-amine