
CAS 75514-37-3
:(2R,2′R,3R,3′R,9S)-2,2′,3,3′-Tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione
Description:
The chemical substance known as (2R,2′R,3R,3′R,9S)-2,2′,3,3′-Tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione, with the CAS number 75514-37-3, is a complex organic compound characterized by its intricate polycyclic structure. This compound features multiple hydroxyl groups, which contribute to its solubility and reactivity, particularly in biological systems. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its interactions with other molecules. The stereochemistry indicated by the R and S designations suggests specific spatial arrangements of its atoms, which can significantly affect its biological activity and properties. This substance may exhibit antioxidant properties due to its hydroxyl groups, making it of interest in various fields, including pharmacology and materials science. Its unique structural features and potential applications warrant further investigation into its behavior and utility in different chemical contexts.
Formula:C30H26O10
InChI:InChI=1S/C30H26O10/c1-9-11(3)39-19-5-13-21(15(31)7-17(33)23(13)29(37)25(19)27(9)35)22-14-6-20-26(28(36)10(2)12(4)40-20)30(38)24(14)18(34)8-16(22)32/h5-12,31-34,37-38H,1-4H3
InChI key:InChIKey=RHNVLFNWDGWACV-UHFFFAOYSA-N
SMILES:OC1=C(C2=C(C(O)=C3C(=C2)OC(C)C(C)C3=O)C(O)=C1)C=4C5=C(C(O)=C6C(=C5)OC(C)C(C)C6=O)C(O)=CC4O
Synonyms:- 4H-Naphtho[2,3-b]pyran, bimol. deriv.
- (2R,2′R,3R,3′R,9S)-2,2′,3,3′-Tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione
- Chaetochromin A
- [9,9′-Bi-4H-naphtho[2,3-b]pyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl-, stereoisomer
- [9,9′-Bi-4H-naphtho[2,3-b]pyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl-, (2R,2′R,3R,3′R,9S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Chaetochromin
CAS:Chaetochromin (4548-G05, NSC 345647) is an oral, selective insulin receptor agonist with potent, lasting antidiabetic effects in mice.Formula:C30H26O10Color and Shape:SolidMolecular weight:546.52
