CymitQuimica logo

CAS 75524-31-1

:

(2S,5R,6R)-6-({[3-(2-chloro-6-fluorophenyl)-5-(hydroxymethyl)-1,2-oxazol-4-yl]carbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid

Description:
The chemical substance with the name "(2S,5R,6R)-6-({[3-(2-chloro-6-fluorophenyl)-5-(hydroxymethyl)-1,2-oxazol-4-yl]carbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid" and CAS number "75524-31-1" is a complex organic compound characterized by its bicyclic structure, which includes a thia and azabicyclo framework. This compound features multiple functional groups, including a carboxylic acid, an oxazole ring, and a chlorofluorophenyl moiety, contributing to its potential biological activity. The stereochemistry is specified by the (2S,5R,6R) configuration, indicating specific spatial arrangements of its chiral centers, which can significantly influence its pharmacological properties. The presence of the hydroxymethyl group and the carbonyl amino linkage suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's intricate structure and functional diversity may confer unique properties, potentially relevant for therapeutic applications.
Formula:C19H17ClFN3O6S
InChI:InChI=1/C19H17ClFN3O6S/c1-19(2)14(18(28)29)24-16(27)13(17(24)31-19)22-15(26)11-9(6-25)30-23-12(11)10-7(20)4-3-5-8(10)21/h3-5,13-14,17,25H,6H2,1-2H3,(H,22,26)(H,28,29)/t13-,14+,17-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.