CAS 75533-14-1

(1R,2R,4S,9R)-6-amino-2,4-dihydroxy-9-methyl-5,8-dioxo-1,2,3,4,5,8-hexahydro-1,4-(epoxymethano)naphthalene-7-carboxamide

Description:

The chemical substance with the name "(1R,2R,4S,9R)-6-amino-2,4-dihydroxy-9-methyl-5,8-dioxo-1,2,3,4,5,8-hexahydro-1,4-(epoxymethano)naphthalene-7-carboxamide" and CAS number "75533-14-1" is a complex organic compound characterized by its multi-functional groups, including amino, hydroxy, and carboxamide functionalities. This compound features a naphthalene core structure that is heavily substituted, indicating potential biological activity. The presence of multiple hydroxyl groups suggests it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The stereochemistry, indicated by the specific R and S configurations, implies that the compound may have distinct spatial arrangements that could affect its interaction with biological targets. Additionally, the dioxo and epoxymethano groups may contribute to its reactivity and stability. Overall, this compound's intricate structure suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation.

Formula: C₁₃H₁₄N₂O₆

InChI: InChI=1/C13H14N2O6/c1-3-13(20)2-4(16)11(21-3)5-7(13)10(18)8(14)6(9(5)17)12(15)19/h3-4,11,16,20H,2,14H2,1H3,(H2,15,19)/t3-,4-,11+,13-/m1/s1

Sarcinamycin-A

CAS: 75533-14-1

Formula: C₁₃H₁₄N₂O₆

Purity: 97.33%

Color and Shape: Red amorphous solid

Molecular weight: 294.0

Ref: 8R-CH0031

Sarubicin A

CAS: 75533-14-1

Sarubicin A (U-58431) is an antibiotic capable of inhibiting both Gram-positive and Gram-negative bacteria and exhibits antitumor activity.

Formula: C₁₃H₁₄N₂O₆

Molecular weight: 294.26

Ref: TM-T203683