CAS 75539-63-8
:Oxirane, 3-[1-[3-(4-methoxyphenyl)-2-propenyl]-3-methyl-2,4-pentadienyl]-2,2-dimethyl-
Description:
Oxirane, 3-[1-[3-(4-methoxyphenyl)-2-propenyl]-3-methyl-2,4-pentadienyl]-2,2-dimethyl- is a complex organic compound characterized by its oxirane (epoxide) structure, which features a three-membered cyclic ether. This compound contains multiple functional groups, including an allylic side chain with a methoxyphenyl moiety, contributing to its potential reactivity and biological activity. The presence of double bonds in the pentadienyl chain suggests that it may participate in various chemical reactions, such as polymerization or electrophilic addition. The methoxy group enhances its solubility in organic solvents and may influence its interaction with biological systems. Additionally, the compound's stereochemistry, influenced by the presence of multiple chiral centers, can significantly affect its chemical behavior and biological activity. Overall, this substance may have applications in fields such as organic synthesis, medicinal chemistry, or materials science, although specific applications would depend on further research into its properties and reactivity.
Formula:C20H26O2
InChI:InChI=1S/C20H26O2/c1-6-15(2)14-17(19-20(3,4)22-19)9-7-8-16-10-12-18(21-5)13-11-16/h6-8,10-14,17,19H,1,9H2,2-5H3
InChI key:InChIKey=JVHUDTINIJAQHA-UHFFFAOYSA-N
SMILES:C(C=C(C=C)C)(CC=CC1=CC=C(OC)C=C1)C2C(C)(C)O2
Synonyms:- Juvocimene II
- Juvocimene 2
- Oxirane, 3-[1-[3-(4-methoxyphenyl)-2-propenyl]-3-methyl-2,4-pentadienyl]-2,2-dimethyl-
- Oxirane, 3-(1-(3-(4-methoxyphenyl)-2-propenyl)-3-methyl-2,4-pentadienyl)-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Juvocimene II
CAS:Juvocimene I and II are isolated from the essential oil of sweet basil,Ocimum basilicum L are effective juvenile hormone mimics.Formula:C20H26O2Color and Shape:SolidMolecular weight:298.42
