CAS 75541-63-8

methyl 2-[(phenylacetyl)amino]benzoate

Description:

Methyl 2-[(phenylacetyl)amino]benzoate, with the CAS number 75541-63-8, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester group, a phenylacetylamino group, and a benzoate moiety, which contribute to its chemical properties. This compound is typically characterized by its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic structures. Methyl 2-[(phenylacetyl)amino]benzoate may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drug candidates. Its structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. Additionally, the presence of both ester and amide functional groups may influence its reactivity and stability under different conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₁₆H₁₅NO₃

InChI: InChI=1/C16H15NO3/c1-20-16(19)13-9-5-6-10-14(13)17-15(18)11-12-7-3-2-4-8-12/h2-10H,11H2,1H3,(H,17,18)

SMILES: COC(=O)c1ccccc1N=C(Cc1ccccc1)O

Synonyms:

• Benzoic Acid, 2-[(2-Phenylacetyl)Amino]-, Methyl Ester
• Methyl 2-[(phenylacetyl)amino]benzoate