CAS 7555-06-8
:L-Histidine ethyl ester
Description:
L-Histidine ethyl ester, with the CAS number 7555-06-8, is a derivative of the amino acid histidine, characterized by the presence of an ethyl ester group. This compound is typically a white to off-white crystalline powder that is soluble in water and organic solvents, reflecting its polar nature due to the amino acid structure. L-Histidine ethyl ester is known for its role in biochemical processes, particularly in protein synthesis and as a precursor for various bioactive molecules. It exhibits properties typical of amino acids, such as the ability to participate in acid-base reactions due to its amino and carboxyl functional groups. Additionally, it may have applications in nutritional supplements and pharmaceuticals, particularly in formulations aimed at enhancing histidine availability in the body. Its stability and reactivity can be influenced by pH and temperature, making it important to consider these factors in storage and handling. Overall, L-Histidine ethyl ester serves as a valuable compound in both research and practical applications in biochemistry and nutrition.
Formula:C8H13N3O2
InChI:InChI=1S/C8H13N3O2/c1-2-13-8(12)7(9)3-6-4-10-5-11-6/h4-5,7H,2-3,9H2,1H3,(H,10,11)/t7-/m0/s1
InChI key:InChIKey=ACHWEOLUTJAHLV-ZETCQYMHSA-N
SMILES:C([C@@H](C(OCC)=O)N)C1=CN=CN1
Synonyms:- L-Histidine ethyl ester
- L-Histidine, ethyl ester
- Histidine, ethyl ester, L-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.