CymitQuimica logo

CAS 75558-07-5

:

2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethanamine

Description:
2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]ethanamine, with CAS number 75558-07-5, is a chemical compound characterized by its complex bicyclic structure, which includes a quinolizidine moiety. This compound features an ethanamine functional group, indicating the presence of an amine (-NH2) attached to an ethyl chain. The stereochemistry is defined by the (1S,9aR) configuration, which influences its biological activity and interactions. Typically, compounds of this nature may exhibit properties relevant to pharmacology, potentially acting as neurotransmitter modulators or having other biological effects. The octahydroquinolizidine structure suggests it may be a saturated nitrogen-containing heterocycle, which can contribute to its stability and solubility in various solvents. Its specific applications and effects would depend on further studies, including its interaction with biological systems and potential therapeutic uses. As with many amines, it may also exhibit basicity, allowing it to participate in acid-base reactions.
Formula:C11H22N2
InChI:InChI=1/C11H22N2/c12-7-6-10-4-3-9-13-8-2-1-5-11(10)13/h10-11H,1-9,12H2/t10-,11+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.