CAS 7556-37-8
:4-Hydroxy-N-methylindole
Description:
4-Hydroxy-N-methylindole is an organic compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a hydroxyl group (-OH) at the 4-position and a methyl group (-CH3) attached to the nitrogen atom of the indole ring. It is typically a white to off-white solid and is soluble in organic solvents. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions in various chemical environments. 4-Hydroxy-N-methylindole is of interest in biochemical research, particularly in studies related to neurotransmitters and as a potential precursor in the synthesis of various pharmaceuticals. Its CAS number, 7556-37-8, is a unique identifier that facilitates the tracking and regulation of this compound in scientific literature and databases. As with many indole derivatives, it may exhibit biological activity, making it a subject of interest in medicinal chemistry and pharmacology.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c1-10-6-5-7-8(10)3-2-4-9(7)11/h2-6,11H,1H3
InChI key:InChIKey=WSMJTXVQAZYLAV-UHFFFAOYSA-N
SMILES:OC1=C2C(N(C)C=C2)=CC=C1
Synonyms:- 1-Methyl-1H-indol-4-ol
- Indol-4-ol, 1-methyl-
- 4-Hydroxy-N-methylindole
- 4-Hydroxy-1-methylindole
- 1H-Indol-4-ol, 1-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Methyl-1H-indol-4-ol
CAS:1-Methyl-1H-indol-4-ol is a sulfur containing natural product that has been shown to have antimicrobial activity. The compound is structurally similar to karanjin, an alkaloid found in the plant genus Camellia. In vitro studies with 1-methyl-1H-indol-4-ol have demonstrated antimicrobial activity against Gram positive bacteria such as Bacillus subtilis and Staphylococcus aureus, as well as anti fungal effects against Candida albicans and Cryptococcus neoformans. Furanoflavonoids are compounds that contain a furan ring and flavonoid group. 1-Methyl-1H-indol-4-ol is one of these compounds and has been shown to inhibit the growth of fungi by inhibiting the synthesis of proteins necessary for cell division.Formula:C9H9NOPurity:Min. 95%Color and Shape:PowderMolecular weight:147.17 g/mol



