CAS 7556-63-0

Methyl 3,4-dihydro-3-oxo-2H-1,4-benzothiazine-2-acetate

Description:

Methyl 3,4-dihydro-3-oxo-2H-1,4-benzothiazine-2-acetate, with the CAS number 7556-63-0, is a chemical compound that belongs to the class of benzothiazine derivatives. This substance typically exhibits a bicyclic structure, characterized by a benzene ring fused to a thiazine ring, which contributes to its unique chemical properties. It is often recognized for its potential biological activity, including anti-inflammatory and analgesic effects, making it of interest in pharmaceutical research. The presence of the acetate group suggests that it may have ester-like properties, influencing its solubility and reactivity. Methyl 3,4-dihydro-3-oxo-2H-1,4-benzothiazine-2-acetate is generally stable under standard conditions but may undergo hydrolysis in the presence of strong acids or bases. Its molecular interactions can be influenced by the functional groups present, which may affect its pharmacokinetics and bioavailability. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₁NO₃S

InChI: InChI=1/C11H11NO3S/c1-15-10(13)6-9-11(14)12-7-4-2-3-5-8(7)16-9/h2-5,9H,6H2,1H3,(H,12,14)

SMILES: COC(=O)CC1C(=Nc2ccccc2S1)O

Synonyms:

• 2H-1,4-benzothiazine-2-acetic acid, 3,4-dihydro-3-oxo-, methyl ester
• methyl (3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate