CAS 7556-92-5
:6-methoxyquinazoline
Description:
6-Methoxyquinazoline is a heterocyclic organic compound characterized by a quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a methoxy group (-OCH3) at the 6-position of the quinazoline ring influences its chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic nature. 6-Methoxyquinazoline is of interest in medicinal chemistry, as derivatives of quinazoline have been studied for their potential biological activities, including anti-cancer and anti-inflammatory properties. The compound's molecular structure allows for various substitution patterns, which can further modify its pharmacological profile. Additionally, it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, making it a versatile building block in organic synthesis. As with many organic compounds, safety precautions should be taken when handling 6-methoxyquinazoline, as its toxicity and environmental impact should be assessed in accordance with relevant safety guidelines.
Formula:C9H8N2O
InChI:InChI=1/C9H8N2O/c1-12-8-2-3-9-7(4-8)5-10-6-11-9/h2-6H,1H3
SMILES:COc1ccc2c(c1)cncn2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
6-Methoxyquinazoline
CAS:6-Methoxyquinazoline is an experimental drug that is a quinazoline derivative. It has been shown to be effective against potassium ion channels, which are involved in the regulation of voltage and membrane potential. The synthetic process for 6-Methoxyquinazoline starts with the conversion of hexamethylenetetramine into aniline followed by the reaction of the aniline with ferricyanide to form a ketone. The ketones are then condensed with methylamine, yielding 6-methoxyquinazoline. This synthesis can be optimized using conditions such as temperature, time, solvent, and reagents. The selectivity of this synthesis can be increased through use of various solvents or reagents, as well as by increasing the number of cycles.
Formula:C9H8N2OPurity:Min. 95%Molecular weight:160.17 g/mol
