CymitQuimica logo

CAS 7556-99-2

:

7-chloroquinazoline

Description:
7-Chloroquinazoline is a heterocyclic organic compound characterized by a quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the 7-position of the quinazoline ring significantly influences its chemical properties and reactivity. This compound is typically a white to off-white solid and is known for its role in medicinal chemistry, particularly as a scaffold for developing various bioactive molecules. It exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many heterocycles. The chlorine substituent can enhance the compound's biological activity and lipophilicity, making it a valuable candidate in drug discovery. Additionally, 7-chloroquinazoline can participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, which are essential for synthesizing more complex derivatives. Its unique structural features and reactivity profile make it an important compound in the fields of pharmaceuticals and agrochemicals.
Formula:C8H5ClN2
InChI:InChI=1/C8H5ClN2/c9-7-2-1-6-4-10-5-11-8(6)3-7/h1-5H
InChI key:YAPDIXAODMCKCH-UHFFFAOYSA-N
SMILES:c1cc(cc2c1cncn2)Cl
Synonyms:
  • Quinazoline, 7-Chloro-
Found 4 products.