CAS 75567-38-3
:20-Deoxyingenol 3-angelate
Description:
20-Deoxyingenol 3-angelate is a chemical compound belonging to the class of ingenol derivatives, which are known for their potential biological activities. This substance is characterized by its unique molecular structure, which includes a fused ring system and specific functional groups that contribute to its reactivity and properties. It is typically a pale yellow to brownish solid, and its solubility can vary depending on the solvent used. The compound has garnered interest in the field of medicinal chemistry due to its potential applications in cancer therapy and as an anti-inflammatory agent. Its mechanism of action is thought to involve modulation of cellular signaling pathways, although further research is necessary to fully elucidate its biological effects. Additionally, 20-Deoxyingenol 3-angelate may exhibit cytotoxic properties against certain cancer cell lines, making it a subject of ongoing pharmacological studies. As with many chemical substances, safety and handling precautions are essential when working with this compound in laboratory settings.
Formula:C25H34O5
InChI:InChI=1S/C25H34O5/c1-8-12(2)22(28)30-21-14(4)11-24-15(5)10-17-18(23(17,6)7)16(20(24)27)9-13(3)19(26)25(21,24)29/h8-9,11,15-19,21,26,29H,10H2,1-7H3/b12-8-/t15-,16+,17-,18+,19-,21+,24+,25+/m1/s1
InChI key:InChIKey=UQOWJJGOQJONCI-MZRDIQIISA-N
SMILES:O[C@@]12[C@@]3(C(=O)[C@]([C@]4([C@@](C[C@H]3C)(C4(C)C)[H])[H])(C=C(C)[C@H]1O)[H])C=C(C)[C@@H]2OC(/C(=C\C)/C)=O
Synonyms:- 1H-2,8a-Methanocyclopenta[a]cyclopropa[e]cyclodecene,2-butenoic acid deriv.
- 2-Butenoic acid, 2-methyl-, (1aR,2S,5R,5aS,6S,8aS,9R,10aR)-1a,2,5,5a,6,9,10,10a-octahydro-5,5a-dihydroxy-1,1,4,7,9-pentamethyl-11-oxo-1H-2,8a-methanocyclopenta[a]cyclopropa[e]cyclodecen-6-yl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 1a,2,5,5a,6,9,10,10a-octahydro-5,5a-dihydroxy-1,1,4,7,9-pentamethyl-11-oxo-1H-2,8a-methanocyclopenta[a]cyclopropa[e]cyclodecen-6-yl ester, [1aR-[1aα,2β,5β,5aβ,6β(Z),8aα,9α,10aα]]-
- 2-Butenoicacid, 2-methyl-,1a,2,5,5a,6,9,10,10a-octahydro-5,5a-dihydroxy-1,1,4,7,9-pentamethyl-11-oxo-1H-2,8a-methanocyclopenta[a]cyclopropa[e]cyclodecen-6-ylester, [1aR-[1aa,2b,5b,5ab,6b(Z),8aa,9a,10aa]]-
- 20-Deoxyingenol 3-angelate
- 3-Angeloyl-20-deoxyingenol
- 3-Angelyl-20-deoxyingenol
- 3β-O-Angeloyl-20-deoxyingenol
- Euphorbia factor H8
- Euphorbia factor H<sub>8</sub>
- Pep 006
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
20-Deoxyingenol 3-angelate
CAS:20-Deoxyingenol 3-angelate promotes mouse skin tumors and induces platelet aggregation via PKC activation.Formula:C25H34O5Purity:98%Color and Shape:SolidMolecular weight:414.54220-Deoxyingenol 3-angelate
CAS:20-Deoxyingenol 3-angelate is a naturally derived diterpene ester, which is isolated from the Euphorbia species. This compound acts primarily by modulating the protein kinase C (PKC) pathway, which plays a critical role in cell signaling, proliferation, and differentiation. Its unique mode of action enables it to interfere with specific cellular processes, making it a promising candidate for research into cancer treatment and other proliferative disorders.
Formula:C25H34O5Purity:Min. 95%Color and Shape:PowderMolecular weight:414.5 g/mol


