CAS 75567-58-7
:1-methyl-3-nitro-5H-pyrido[4,3-b]indole
Description:
1-Methyl-3-nitro-5H-pyrido[4,3-b]indole is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and indole moieties. This compound features a methyl group and a nitro group, contributing to its chemical reactivity and potential biological activity. The presence of the nitro group often enhances the compound's electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Its unique structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry and drug development. The compound is typically synthesized through multi-step organic reactions, and its properties can be influenced by factors such as solvent, temperature, and reaction conditions. As with many nitro-containing compounds, it may exhibit toxicity and requires careful handling. Overall, 1-methyl-3-nitro-5H-pyrido[4,3-b]indole represents a fascinating subject for research in both synthetic and applied chemistry contexts.
Formula:C12H9N3O2
InChI:InChI=1/C12H9N3O2/c1-7-12-8-4-2-3-5-9(8)14-10(12)6-11(13-7)15(16)17/h2-6,14H,1H3
SMILES:Cc1c2c3ccccc3[nH]c2cc(n1)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Nitro-1-methyl-5H-pyrido[4,3-b]indole
CAS:Controlled ProductApplications A highly mutagenic metabolite of 3-Amino-1-methyl-5H-pyrido[4,3-b]indole (Trp-P-2) (A618001); mutagen-carcinogen product towards Salmonella typhimurium TA 98.
References Saito, K., et al.: Carcinogenesis, 4, 1547 (1983), Hashimoto, Y., et al.: Biochem. Biophysical Res. Communications, 96, 355 (1980),Formula:C12H9N3O2Color and Shape:NeatMolecular weight:227.219
