
CAS 755710-53-3
:1(5H)-Phenazinimine
Description:
1(5H)-Phenazinimine, identified by the CAS number 755710-53-3, is a chemical compound that belongs to the class of phenazines, which are bicyclic compounds containing nitrogen atoms in their structure. This substance typically exhibits a deep color, often associated with its conjugated system, which can contribute to its optical properties. It is characterized by its imine functional group, which is a nitrogen double-bonded to a carbon atom, influencing its reactivity and potential applications in organic synthesis and materials science. The presence of the phenazine core suggests potential biological activity, as many phenazine derivatives are known for their antimicrobial and antitumor properties. Additionally, 1(5H)-Phenazinimine may exhibit interesting electronic properties, making it a candidate for use in organic electronics or as a dye. Its stability, solubility, and reactivity can vary depending on the specific conditions and substituents present in the molecule. As with many chemical substances, safety precautions should be taken when handling it, given the potential hazards associated with nitrogen-containing compounds.
Formula:C12H9N3
InChI:InChI=1S/C12H9N3/c13-8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7,13-14H
InChI key:InChIKey=DBIDMOONLWEWAA-UHFFFAOYSA-N
SMILES:N=C1C=2C(NC=3C(N2)=CC=CC3)=CC=C1
Synonyms:- 1(5H)-Phenazinimine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
