CAS 7559-45-7
:S-octyl methanesulfonothioate
Description:
S-octyl methanesulfonothioate, with the CAS number 7559-45-7, is an organosulfur compound characterized by its methanesulfonothioate functional group attached to an octyl chain. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive odor. It is soluble in organic solvents but has limited solubility in water, which is common for many organosulfur compounds. S-octyl methanesulfonothioate is primarily utilized in agricultural applications, particularly as a pesticide or insecticide, due to its ability to disrupt the biological processes of pests. Its mode of action often involves interference with neurotransmission in target organisms. Additionally, this compound may exhibit properties such as low volatility and moderate stability under standard conditions, making it suitable for use in various formulations. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose risks to human health and the environment if not managed properly. Always refer to safety data sheets and regulatory guidelines when working with such chemicals.
Formula:C9H20O2S2
InChI:InChI=1/C9H20O2S2/c1-3-4-5-6-7-8-9-12-13(2,10)11/h3-9H2,1-2H3
SMILES:CCCCCCCCSS(=O)(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.