CAS 7559-62-8
:S-benzyl methanesulfonothioate
Description:
S-benzyl methanesulfonothioate, with the CAS number 7559-62-8, is an organosulfur compound characterized by the presence of a methanesulfonothioate group attached to a benzyl moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive sulfur-containing functional groups, which contribute to its reactivity and potential applications in organic synthesis. It is soluble in organic solvents, making it useful in various chemical reactions, particularly in the formation of thioether linkages. S-benzyl methanesulfonothioate can act as a reagent in nucleophilic substitution reactions and is often utilized in the synthesis of more complex organic molecules. Additionally, due to its sulfur content, it may exhibit biological activity, although specific biological properties would depend on the context of its use. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested. Overall, S-benzyl methanesulfonothioate is a valuable compound in the field of synthetic organic chemistry.
Formula:C8H10O2S2
InChI:InChI=1/C8H10O2S2/c1-12(9,10)11-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3
SMILES:CS(=O)(=O)SCc1ccccc1
Synonyms:- Benzyl Methanethiosulfonate
- methanesulfonothioic acid, S-(phenylmethyl) ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
S-Benzyl methanethiosulphonate
CAS:S-Benzyl methanethiosulphonateFormula:C8H10O2S2Purity:≥95%Color and Shape: off-white solidMolecular weight:202.29g/molBenzyl Methanethiosulfonate
CAS:Controlled ProductApplications Reacts specifically and rapidly with thiols to form mixed disulfides. Used to probe the structures of the ACh receptor channel of the GABA receptor channel and of lactose permease.
References Kuner, T., et al.: Neuron, 17, 343 (1996), Yang, N., et al.: Neuron, 16, 113 (1996), Chahine, M., et al.: Biochem. Biophysical Res. Commun., 233, 606 (1997), Li, R., et al.: Circ. Res., 85, 88 (1999)Formula:C8H10O2S2Color and Shape:NeatMolecular weight:202.29

