CAS 7559-81-1
:Chlorokojic acid
Description:
Chlorokojic acid, with the CAS number 7559-81-1, is an organic compound that belongs to the class of kojic acid derivatives. It is characterized by the presence of a chlorinated phenolic structure, which contributes to its unique chemical properties. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents. Chlorokojic acid is known for its potential applications in the cosmetic industry, particularly as a skin-lightening agent due to its ability to inhibit tyrosinase, an enzyme involved in melanin production. Additionally, it exhibits antioxidant properties, making it valuable in formulations aimed at protecting the skin from oxidative stress. Safety and regulatory considerations are essential when using chlorokojic acid, as with any chemical, to ensure it is used within recommended concentrations to minimize potential skin irritation or sensitization. Overall, chlorokojic acid is a versatile compound with significant relevance in both chemical research and cosmetic applications.
Formula:C6H5ClO3
InChI:InChI=1/C6H5ClO3/c7-2-4-1-5(8)6(9)3-10-4/h1,3,9H,2H2
InChI key:InChIKey=WSVIQCQIJLDTEK-UHFFFAOYSA-N
SMILES:C(Cl)C1=CC(=O)C(O)=CO1
Synonyms:- 2-Chloromethyl-5-Hydroxy-4-Pyranone
- 2-Chloromethyl-5-hydroxy-4-pyrone
- 2-Chloromethyl-5-hydroxypyran-4-one
- 4H-Pyran-4-one, 2- (chloromethyl)-5-hydroxy-
- 5-Hydroxy-2-(chloromethyl)-4H-pyran-4-one
- 7559-81-1
- Chlorokojic acid
- NSC 10216
- NSC 298537
- 2-(Chloromethyl)-5-hydroxy-4H-pyran-4-one
- 2-(chloromethyl)-5-hydroxy-4h-pyran-4-on
- Kojic Impurity 4
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Chloromethyl)-5-hydroxy-4H-pyran-4-one
CAS:Formula:C6H5ClO3Purity:95%Color and Shape:SolidMolecular weight:160.55512-(Chloromethyl)-5-hydroxy-4H-pyran-4-one
CAS:2-(Chloromethyl)-5-hydroxy-4H-pyran-4-onePurity:95%Molecular weight:160.56g/mol2-(CHLOROMETHYL)-5-HYDROXY-4H-PYRAN-4-ONE
CAS:Formula:C6H5ClO3Purity:98%Color and Shape:No data available.Molecular weight:160.552-(Chloromethyl)-5-hydroxy-4H-pyran-4-one
CAS:2-(Chloromethyl)-5-hydroxy-4H-pyran-4-one (2CHP) is a nucleophilic compound that has been shown to be effective against colorectal adenocarcinoma cells. 2CHP is synthesized from the reaction of 2,5-dichloro-4H-pyran with hydroxylamine and HCl in water. It is also used for the treatment of infectious diseases such as malaria and tuberculosis. This compound induces tyrosinase activity through an intramolecular hydrogen bond with the hydroxyl group, which causes the hydroxyl group to become nucleophilic and react with a chlorine atom in order to form an acid conjugate.Formula:C6H5ClO3Purity:Min. 95%Molecular weight:160.56 g/mol



