CAS 75590-33-9
:(3E,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4-dimethoxyphenyl)methylidene]dihydrofuran-2(3H)-one
Description:
The chemical substance known as "(3E,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4-dimethoxyphenyl)methylidene]dihydrofuran-2(3H)-one," with the CAS number 75590-33-9, is a complex organic compound characterized by its unique structural features. It contains a dihydrofuran ring, which is a five-membered cyclic compound with two oxygen atoms, and is substituted with various functional groups, including a benzodioxole moiety and a dimethoxyphenyl group. This compound exhibits potential biological activity, often studied for its pharmacological properties, including anti-inflammatory and antioxidant effects. The stereochemistry indicated by the (3E,4R) configuration suggests specific spatial arrangements of atoms, which can influence its reactivity and interactions with biological targets. Additionally, the presence of multiple aromatic rings contributes to its stability and may enhance its lipophilicity, affecting its solubility and bioavailability. Overall, this compound represents a class of organic molecules that may have applications in medicinal chemistry and drug development.
Formula:C21H20O6
InChI:InChI=1/C21H20O6/c1-23-17-5-3-14(9-19(17)24-2)8-16-15(11-25-21(16)22)7-13-4-6-18-20(10-13)27-12-26-18/h3-6,8-10,15H,7,11-12H2,1-2H3/b16-8+/t15-/m0/s1
Synonyms:- (3E,4R)-4-(1,3-Benzodioxol-5-ylmethyl)-3-(3,4-dimethoxybenzylidene)dihydrofuran-2(3H)-one
- 2(3H)-Furanone, 4-(1,3-benzodioxol-5-ylmethyl)-3-((3,4-dimethoxyphenyl)methylene)dihydro-, (3E,4R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Kaerophyllin
CAS:Kaerophyllin ( (-)-Kaerophylin) protects rat liver from TAA-induced injury by suppressing hepatic inflammation and inhibiting HSC activation.Formula:C21H20O6Purity:98%Color and Shape:SolidMolecular weight:368.38Kaerophyllin
CAS:<p>Kaerophyllin is a cannabinoid-based product derived from the hemp plant, specifically known for its rich content of beta-caryophyllene. This natural compound is extracted from industrial hemp, a variety of Cannabis sativa that is legally cultivated for its low tetrahydrocannabinol (THC) content. The primary mode of action of Kaerophyllin involves the selective activation of the CB2 receptors in the endocannabinoid system, thereby influencing various physiological processes.</p>Formula:C21H20O6Purity:Min. 95%Molecular weight:368.4 g/mol




