CymitQuimica logo

CAS 7560-51-2

:

Bis(trimethylsilyl) B-phenylboronate

Description:
Bis(trimethylsilyl) B-phenylboronate is an organoboron compound characterized by its boron atom bonded to a phenyl group and two trimethylsilyl groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its stability and solubility in organic solvents, making it useful in various synthetic applications, particularly in organic chemistry and materials science. The presence of trimethylsilyl groups enhances its reactivity and solubility, facilitating its use in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is pivotal in forming carbon-carbon bonds. Additionally, bis(trimethylsilyl) B-phenylboronate can serve as a precursor for the synthesis of other boron-containing compounds. Its chemical behavior is influenced by the electron-donating properties of the trimethylsilyl groups, which can affect the reactivity of the boron center. Overall, this compound is valuable in the development of pharmaceuticals, agrochemicals, and advanced materials due to its versatile reactivity and functionalization potential.
Formula:C12H23BO2Si2
InChI:InChI=1S/C12H23BO2Si2/c1-16(2,3)14-13(15-17(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3
InChI key:InChIKey=QHKVZAHYVMMIRZ-UHFFFAOYSA-N
SMILES:B(O[Si](C)(C)C)(O[Si](C)(C)C)C1=CC=CC=C1
Synonyms:
  • Boronic acid, phenyl-, bis(trimethylsilyl) ester
  • Phenylbis(trimethylsiloxy)borane
  • Benzeneboronic acid, bis(trimethylsilyl) ester
  • Boronic acid, B-phenyl-, bis(trimethylsilyl) ester
  • Bis(trimethylsilyl) B-phenylboronate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.