CAS 75605-52-6

1-(Benzylamino)-3-chloropropan-2-ol

Description:

1-(Benzylamino)-3-chloropropan-2-ol, with the CAS number 75605-52-6, is an organic compound characterized by the presence of a benzylamino group and a chloropropanol moiety. This compound typically exhibits a chiral center at the second carbon, leading to potential stereoisomerism. It is a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the chlorinated propanol structure suggests it may participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the benzylamino group can engage in hydrogen bonding, influencing its solubility in various solvents. The compound may also exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted, as the chlorinated compounds can pose health risks, including potential toxicity. Overall, 1-(Benzylamino)-3-chloropropan-2-ol is a versatile compound with applications in chemical synthesis and possibly in pharmaceutical development.

Formula: C₁₀H₁₄ClNO

InChI: InChI=1/C10H14ClNO/c11-6-10(13)8-12-7-9-4-2-1-3-5-9/h1-5,10,12-13H,6-8H2

SMILES: c1ccc(cc1)CNCC(CCl)O

Synonyms:

• 2-Propanol, 1-chloro-3-((phenylmethyl)amino)-
• benzyl-(1-amino-3-chloro-2-propanol)
• 1-(benzylaMino)-3-chloropropan-2-ol

2-Propanol,1-chloro-3-[(phenylmethyl)amino]-

CAS: 75605-52-6

Formula: C₁₀H₁₄ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 199.67726000000002

Ref: IN-DA005WFM