CAS 7561-62-8
:2-(2,4-dimethylphenyl)-1H-indene-1,3(2H)-dione
Description:
2-(2,4-Dimethylphenyl)-1H-indene-1,3(2H)-dione, with the CAS number 7561-62-8, is an organic compound characterized by its indene structure, which features a fused ring system comprising a five-membered and a six-membered ring. This compound exhibits a diketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the 2,4-dimethylphenyl substituent enhances its hydrophobic characteristics and may influence its biological activity. Typically, compounds of this nature can exhibit properties such as fluorescence, making them useful in various fields, including materials science and pharmaceuticals. Additionally, the compound may participate in various chemical reactions, such as condensation and oxidation, due to the reactivity of the diketone moiety. Its specific applications and behavior can vary based on the surrounding conditions, such as solvent and temperature. Overall, 2-(2,4-dimethylphenyl)-1H-indene-1,3(2H)-dione is a versatile compound with potential utility in synthetic chemistry and material development.
Formula:C17H14O2
InChI:InChI=1/C17H14O2/c1-10-7-8-12(11(2)9-10)15-16(18)13-5-3-4-6-14(13)17(15)19/h3-9,15H,1-2H3
Synonyms:- 1H-indene-1,3(2H)-dione, 2-(2,4-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
