CAS 7561-64-0
:(7Z,10Z,13Z)-hexadeca-7,10,13-trienoic acid
Description:
(7Z,10Z,13Z)-hexadeca-7,10,13-trienoic acid, commonly known as alpha-linolenic acid (ALA), is a polyunsaturated fatty acid belonging to the omega-3 family. It is characterized by its long carbon chain, consisting of 16 carbon atoms and three double bonds located at the 7th, 10th, and 13th positions, all in the cis configuration. This structure contributes to its fluidity and reactivity, making it an essential component in biological membranes. ALA is primarily found in plant oils, such as flaxseed, chia seeds, and walnuts, and plays a crucial role in human nutrition as it cannot be synthesized by the body. It serves as a precursor for the synthesis of other important omega-3 fatty acids, such as eicosapentaenoic acid (EPA) and docosahexaenoic acid (DHA). ALA is known for its potential health benefits, including anti-inflammatory properties and cardiovascular health support. Its presence in the diet is associated with various health benefits, making it an important focus in nutritional studies.
Formula:C16H26O2
InChI:InChI=1/C16H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h3-4,6-7,9-10H,2,5,8,11-15H2,1H3,(H,17,18)/b4-3-,7-6-,10-9-
SMILES:CC/C=C\C/C=C\C/C=C\CCCCCC(=O)O
Synonyms:- 7,10,13-hexadecatrienoic acid, (7Z,10Z,13Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7(Z),10(Z),13(Z)-Hexadecatrienoic acid
CAS:<p>7(Z),10(Z),13(Z)-Hexadecatrienoic acid (Roughanic acid) is an ω-3 polyunsaturated fatty acid (PUFA) located in the leaves of S. olusatrum. This compound serves as an intermediate in the synthesis of Jasmonic acid.</p>Formula:C16H26O2Color and Shape:SolidMolecular weight:250.387(Z),10(Z),13(Z)-Hexadecatrienoic acid
CAS:Formula:C16H26O2Purity:>98%Color and Shape:In solution, EthanolMolecular weight:250.387(Z),10(Z),13(Z)-Hexadecatrienoic Acid
CAS:Controlled ProductFormula:C16H26O2Color and Shape:NeatMolecular weight:250.3767(Z),10(Z),13(Z)-Hexadecatrienoic acid
CAS:<p>Please enquire for more information about 7(Z),10(Z),13(Z)-Hexadecatrienoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C16H26O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:250.38 g/molRef: 4Z-F-106122
Discontinued product




