CymitQuimica logo

CAS 75611-78-8

:

(3S,4R)-3-hydroxy-2,2-dimethyl-4-pyrrolidin-1-yl-chromane-6-carbonitrile

Description:
(3S,4R)-3-hydroxy-2,2-dimethyl-4-pyrrolidin-1-yl-chromane-6-carbonitrile, with the CAS number 75611-78-8, is a chemical compound characterized by its complex structure that includes a chromane core, a pyrrolidine ring, and a carbonitrile functional group. The stereochemistry indicated by the (3S,4R) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's biological activity and interactions. This compound is likely to exhibit properties typical of chromane derivatives, such as potential antioxidant activity, and may interact with various biological targets due to the presence of the hydroxyl and carbonitrile groups. The dimethyl substitution on the chromane structure can enhance lipophilicity, potentially affecting its solubility and permeability in biological systems. Overall, the unique combination of functional groups and stereochemistry contributes to its potential applications in medicinal chemistry and pharmacology, although specific biological activities would require empirical investigation.
Formula:C16H20N2O2
InChI:InChI=1/C16H20N2O2/c1-16(2)15(19)14(18-7-3-4-8-18)12-9-11(10-17)5-6-13(12)20-16/h5-6,9,14-15,19H,3-4,7-8H2,1-2H3/t14-,15+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.