CAS 75614-93-6
:(2S)-1-(1H-imidazol-4-yl)propan-2-amine dihydrobromide
Description:
(2S)-1-(1H-imidazol-4-yl)propan-2-amine dihydrobromide, with the CAS number 75614-93-6, is a chemical compound characterized by its chiral center, which contributes to its specific stereochemistry. This compound features an imidazole ring, a five-membered aromatic heterocycle containing two nitrogen atoms, which is known for its biological activity and role in various biochemical processes. The presence of the propan-2-amine moiety indicates that it is an amine, which can participate in hydrogen bonding and may exhibit basic properties. The dihydrobromide form suggests that the compound is a salt, enhancing its solubility in polar solvents, which is often advantageous for pharmaceutical applications. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways, given the significance of imidazole derivatives in pharmacology. Its characteristics, including solubility, stability, and reactivity, would be influenced by the presence of the bromide ions and the overall molecular structure.
Formula:C6H13Br2N3
InChI:InChI=1/C6H11N3.2BrH/c1-5(7)2-6-3-8-4-9-6;;/h3-5H,2,7H2,1H3,(H,8,9);2*1H/t5-;;/m0../s1
SMILES:C[C@@H](Cc1cnc[nH]1)N.Br.Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
