CAS 75618-25-6
:butyl trifluoromethanesulfonate
Description:
Butyl trifluoromethanesulfonate, with the CAS number 75618-25-6, is an organosulfonate compound characterized by the presence of a butyl group attached to a trifluoromethanesulfonate moiety. This compound is typically a colorless to pale yellow liquid and is known for its high reactivity, particularly as an electrophilic reagent in organic synthesis. It features a trifluoromethyl group, which imparts unique electronic properties, making it a useful intermediate in the preparation of various fluorinated compounds. The sulfonate group enhances its solubility in polar solvents, facilitating its use in diverse chemical reactions, including nucleophilic substitutions and as a leaving group in various transformations. Additionally, butyl trifluoromethanesulfonate is valued in the field of medicinal chemistry and materials science for its ability to introduce trifluoromethyl groups into organic molecules, which can significantly alter their biological and physical properties. However, due to its reactivity and potential toxicity, appropriate safety measures should be observed when handling this compound.
Formula:C5H9F3O3S
InChI:InChI=1/C5H9F3O3S/c1-2-3-4-11-12(9,10)5(6,7)8/h2-4H2,1H3
SMILES:CCCCOS(=O)(=O)C(F)(F)F
Synonyms:- Methanesulfonic Acid, 1,1,1-Trifluoro-, Butyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Butyl Trifluoromethanesulfonate
CAS:Butyl trifluoromethanesulfonate is an immunoregulatory agent that has been shown to have insulin-sensitizing and anti-inflammatory properties. It has been reported to cause a significant reduction in the concentration of glucose in the blood, which may be due to its ability to inhibit the synthesis of cholesterol esters. Butyl trifluoromethanesulfonate is also used as a solvent in detergent compositions, and as a reagent for synthesizing quinoline derivatives. This compound has been shown to increase the viscosity of oils and other organic solvents, making it useful for a wide range of industrial applications.Formula:C5H9F3O3SPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:206.18 g/mol




