CAS 75625-24-0
:1,2,3,4,6,7-hexabromonaphthalene
Description:
1,2,3,4,6,7-Hexabromonaphthalene is a polybrominated aromatic compound characterized by the presence of six bromine atoms attached to a naphthalene ring structure. This compound is typically used as a flame retardant due to its ability to inhibit combustion processes. Its molecular structure contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. The presence of multiple bromine atoms enhances its stability and resistance to degradation, which can lead to environmental persistence. Hexabromonaphthalene has raised concerns regarding its potential toxicity and bioaccumulation in aquatic and terrestrial ecosystems. It is important to note that compounds like this may undergo various degradation pathways, leading to the formation of other brominated byproducts. Regulatory measures are increasingly scrutinizing the use of such substances due to their environmental and health impacts, prompting research into safer alternatives and remediation strategies. Overall, 1,2,3,4,6,7-hexabromonaphthalene exemplifies the complexities associated with the use of halogenated compounds in industrial applications.
Formula:C10H2Br6
InChI:InChI=1/C10H2Br6/c11-5-1-3-4(2-6(5)12)8(14)10(16)9(15)7(3)13/h1-2H
SMILES:c1c2c(cc(c1Br)Br)c(c(c(c2Br)Br)Br)Br
Synonyms:- Naphthalene, 1,2,3,4,6,7-Hexabromo-
- 1,2,3,4,6,7-Hexabromonaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,3,4,6,7-Hexabromonaphthalene
CAS:1,2,3,4,6,7-Hexabromonaphthalene
Color and Shape:SolidMolecular weight:601.55g/mol
