CAS 75625-98-8

2-[4-(1-bromo-2-methyl-propyl)phenyl]propanoic acid

Description:

2-[4-(1-bromo-2-methyl-propyl)phenyl]propanoic acid, with the CAS number 75625-98-8, is a chemical compound characterized by its unique structure, which includes a propanoic acid moiety attached to a phenyl group that is further substituted with a bromoalkyl chain. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the bromo substituent suggests that it may participate in nucleophilic substitution reactions, while the propanoic acid functional group indicates acidic properties, allowing it to engage in acid-base reactions. Additionally, the bulky 1-bromo-2-methyl-propyl group may influence the compound's steric hindrance and solubility in various solvents. Such characteristics make it of interest in organic synthesis and medicinal chemistry, where it may serve as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₇BrO₂

InChI: InChI=1/C13H17BrO2/c1-8(2)12(14)11-6-4-10(5-7-11)9(3)13(15)16/h4-9,12H,1-3H3,(H,15,16)

SMILES: CC(C)C(c1ccc(cc1)C(C)C(=O)O)Br