CAS 75629-20-8
:Gomisin K1
Description:
Gomisin K1 is a bioactive compound primarily derived from the fruit of the Schisandra chinensis plant, known for its traditional use in herbal medicine. It belongs to the class of lignans, which are organic compounds characterized by their phenolic structures. Gomisin K1 exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential neuroprotective effects, making it of interest in pharmacological research. The compound has been studied for its ability to modulate various signaling pathways, which may contribute to its therapeutic potential. In terms of physical properties, Gomisin K1 is typically a pale yellow to brownish solid, and it is soluble in organic solvents but has limited solubility in water. Its molecular structure includes multiple aromatic rings and hydroxyl groups, which are responsible for its reactivity and biological interactions. Overall, Gomisin K1 represents a significant area of interest in natural product chemistry and pharmacology, particularly for its potential health benefits.
Formula:C23H30O6
InChI:InChI=1S/C23H30O6/c1-12-8-14-10-16(24)20(26-4)22(28-6)18(14)19-15(9-13(12)2)11-17(25-3)21(27-5)23(19)29-7/h10-13,24H,8-9H2,1-7H3
InChI key:InChIKey=RCPUCQCVTDMJGJ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C(=CC(O)=C(OC)C3OC)CC(C)C(C)CC2=CC(OC)=C1OC
Synonyms:- (-)-Gomisin K<sub>1</sub>
- (6S,7R,12aS)-5,6,7,8-Tetrahydro-1,2,10,11,12-pentamethoxy-6,7-dimethyldibenzo[a,c]cycloocten-3-ol
- Dibenzo[a,c]cycloocten-3-ol,5,6,7,8-tetrahydro-1,2,10,11,12-pentamethoxy-6,7-dimethyl-, stereoisomer
- Gomisin K1
- Dibenzo[a,c]cycloocten-3-ol, 5,6,7,8-tetrahydro-1,2,10,11,12-pentamethoxy-6,7-dimethyl-, (6S,7R,12aS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Gomisin K1
CAS:Gomisin K1 is a natural product from Schizandra chinensis BAILL.Formula:C23H30O6Purity:98%Color and Shape:SolidMolecular weight:402.487Gomisin K1
CAS:Controlled ProductGomisin K1 is a plant extract that has been shown to have potent pharmacological effects, including anti-aging, cancer and multidrug resistance. Gomisin K1 is a biphenyl compound that acts as a drug transporter in the eye and skin. It is also an osmotic agent that can be used in medications for the treatment of dry eyes and dry mouth. Gomisin K1 has also shown potential to inhibit tyrosinase activity and may be able to protect against UV radiation damage.Formula:C23H30O6Purity:Min. 95%Molecular weight:402.5 g/mol


